C13H14Cl2FN7O4S — CID 155558872
N'-(3,5-dichloro-4-fluorophenyl)-4-[2-(1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 155558872) has the molecular formula C13H14Cl2FN7O4S and a molecular weight of 454.27 g/mol. Its IUPAC name is N'-(3,5-dichloro-4-fluorophenyl)-4-[2-(1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3,5-dichloro-4-fluorophenyl)-4-[2-(1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 155558872 |
| Molecular Formula | C13H14Cl2FN7O4S |
| Molecular Weight | 454.27 g/mol |
| Exact Mass | 453.02 |
| IUPAC Name | N'-(3,5-dichloro-4-fluorophenyl)-4-[2-(1,1-dioxo-1,2,5-thiadiazolidin-2-yl)ethylamino]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | O=S1(=O)NCCN1CCNc1nonc1/C(=N/c1cc(Cl)c(F)c(Cl)c1)NO |
| InChI | InChI=1S/C13H14Cl2FN7O4S/c14-8-5-7(6-9(15)10(8)16)19-13(20-24)11-12(22-27-21-11)17-1-3-23-4-2-18-28(23,25)26/h5-6,18,24H,1-4H2,(H,17,22)(H,19,20) |
| InChIKey | AHDJHFYALBQWOG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 144.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.27 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|