C29H32ClN3O2 — CID 155558995
(12aS)-N-[(3-chlorophenyl)methyl]-2-methoxy-7,7,9,12a-tetramethyl-5,6,6a,12-tetrahydronaphtho[1,2-g]quinazoline-3-carboxamide (PubChem CID 155558995) has the molecular formula C29H32ClN3O2 and a molecular weight of 490.05 g/mol. Its IUPAC name is (12aS)-N-[(3-chlorophenyl)methyl]-2-methoxy-7,7,9,12a-tetramethyl-5,6,6a,12-tetrahydronaphtho[1,2-g]quinazoline-3-carboxamide.
| Compound Name | (12aS)-N-[(3-chlorophenyl)methyl]-2-methoxy-7,7,9,12a-tetramethyl-5,6,6a,12-tetrahydronaphtho[1,2-g]quinazoline-3-carboxamide |
|---|---|
| PubChem CID | 155558995 |
| Molecular Formula | C29H32ClN3O2 |
| Molecular Weight | 490.05 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | (12aS)-N-[(3-chlorophenyl)methyl]-2-methoxy-7,7,9,12a-tetramethyl-5,6,6a,12-tetrahydronaphtho[1,2-g]quinazoline-3-carboxamide |
| SMILES | COc1cc2c(cc1C(=O)NCc1cccc(Cl)c1)CCC1C(C)(C)c3nc(C)ncc3C[C@]21C |
| InChI | InChI=1S/C29H32ClN3O2/c1-17-31-16-20-14-29(4)23-13-24(35-5)22(27(34)32-15-18-7-6-8-21(30)11-18)12-19(23)9-10-25(29)28(2,3)26(20)33-17/h6-8,11-13,16,25H,9-10,14-15H2,1-5H3,(H,32,34)/t25?,29-/m1/s1 |
| InChIKey | WEAPPBUQCIXMOC-SNSSHHSLSA-N |
| XLogP | 5.73 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.05 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |