C29H40O8 — CID 155559021
[(1S,3R,5R)-1,3-diacetyloxy-10-hydroxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] (Z)-2-methylbut-2-enoate (PubChem CID 155559021) has the molecular formula C29H40O8 and a molecular weight of 516.63 g/mol. Its IUPAC name is [(1S,3R,5R)-1,3-diacetyloxy-10-hydroxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1S,3R,5R)-1,3-diacetyloxy-10-hydroxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 155559021 |
| Molecular Formula | C29H40O8 |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | [(1S,3R,5R)-1,3-diacetyloxy-10-hydroxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C=CC(=C)CCC1(C)C(C)CC(O)C23C(=C[C@H](OC(=O)/C(C)=C\C)CC12)[C@@H](OC(C)=O)O[C@H]3OC(C)=O |
| InChI | InChI=1S/C29H40O8/c1-9-16(3)11-12-28(8)18(5)13-24(32)29-22(26(34-19(6)30)37-27(29)35-20(7)31)14-21(15-23(28)29)36-25(33)17(4)10-2/h9-10,14,18,21,23-24,26-27,32H,1,3,11-13,15H2,2,4-8H3/b17-10-/t18?,21-,23?,24?,26-,27+,28?,29?/m0/s1 |
| InChIKey | PQVAFCDZYYLAEY-MGKOUKOVSA-N |
| XLogP | 4.54 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|