C28H33ClO7 — CID 155559037
[(1S,2S,5S,8R,9S,10S,11R,15S,18R)-9,10,15-trihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] 4-(chloromethyl)benzoate (PubChem CID 155559037) has the molecular formula C28H33ClO7 and a molecular weight of 517.02 g/mol. Its IUPAC name is [(1S,2S,5S,8R,9S,10S,11R,15S,18R)-9,10,15-trihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] 4-(chloromethyl)benzoate.
| Compound Name | [(1S,2S,5S,8R,9S,10S,11R,15S,18R)-9,10,15-trihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] 4-(chloromethyl)benzoate |
|---|---|
| PubChem CID | 155559037 |
| Molecular Formula | C28H33ClO7 |
| Molecular Weight | 517.02 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | [(1S,2S,5S,8R,9S,10S,11R,15S,18R)-9,10,15-trihydroxy-12,12-dimethyl-6-methylidene-7-oxo-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-18-yl] 4-(chloromethyl)benzoate |
| SMILES | C=C1C(=O)[C@]23[C@H](OC(=O)c4ccc(CCl)cc4)[C@H]1CC[C@H]2[C@@]12CO[C@]3(O)[C@@H](O)[C@@H]1C(C)(C)CC[C@@H]2O |
| InChI | InChI=1S/C28H33ClO7/c1-14-17-8-9-18-26-13-35-28(34,22(32)20(26)25(2,3)11-10-19(26)30)27(18,21(14)31)23(17)36-24(33)16-6-4-15(12-29)5-7-16/h4-7,17-20,22-23,30,32,34H,1,8-13H2,2-3H3/t17-,18-,19-,20+,22-,23+,26+,27-,28+/m0/s1 |
| InChIKey | WIDLFVXQRRJAAZ-LCYAIMSFSA-N |
| XLogP | 2.98 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.02 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|