C22H28FN5O3S — CID 155559146
1-[4-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-pyrimidin-2-ylthiazinan-2-yl]methyl]phenyl]piperazin-1-yl]ethanone (PubChem CID 155559146) has the molecular formula C22H28FN5O3S and a molecular weight of 461.56 g/mol. Its IUPAC name is 1-[4-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-pyrimidin-2-ylthiazinan-2-yl]methyl]phenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-pyrimidin-2-ylthiazinan-2-yl]methyl]phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 155559146 |
| Molecular Formula | C22H28FN5O3S |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 1-[4-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-pyrimidin-2-ylthiazinan-2-yl]methyl]phenyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ccc(CN3[C@@H](C)CC[C@H](c4ncccn4)S3(=O)=O)c(F)c2)CC1 |
| InChI | InChI=1S/C22H28FN5O3S/c1-16-4-7-21(22-24-8-3-9-25-22)32(30,31)28(16)15-18-5-6-19(14-20(18)23)27-12-10-26(11-13-27)17(2)29/h3,5-6,8-9,14,16,21H,4,7,10-13,15H2,1-2H3/t16-,21+/m0/s1 |
| InChIKey | QDJQREKZQORRCO-HRAATJIYSA-N |
| XLogP | 2.34 |
| TPSA | 86.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|