C25H26N4O3S — CID 155559170
N-[2-[(4-methylphenyl)sulfonylamino]ethyl]-3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanamide (PubChem CID 155559170) has the molecular formula C25H26N4O3S and a molecular weight of 462.58 g/mol. Its IUPAC name is N-[2-[(4-methylphenyl)sulfonylamino]ethyl]-3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanamide.
| Compound Name | N-[2-[(4-methylphenyl)sulfonylamino]ethyl]-3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 155559170 |
| Molecular Formula | C25H26N4O3S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | N-[2-[(4-methylphenyl)sulfonylamino]ethyl]-3-[4-(1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]propanamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNC(=O)CCc2ccc(-c3cnc4[nH]ccc4c3)cc2)cc1 |
| InChI | InChI=1S/C25H26N4O3S/c1-18-2-9-23(10-3-18)33(31,32)29-15-14-26-24(30)11-6-19-4-7-20(8-5-19)22-16-21-12-13-27-25(21)28-17-22/h2-5,7-10,12-13,16-17,29H,6,11,14-15H2,1H3,(H,26,30)(H,27,28) |
| InChIKey | BRIVRANKZZWLFA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|