C19H18F2N4O2 — CID 155559224
N-butyl-2-[(3,4-difluorobenzoyl)amino]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 155559224) has the molecular formula C19H18F2N4O2 and a molecular weight of 372.38 g/mol. Its IUPAC name is N-butyl-2-[(3,4-difluorobenzoyl)amino]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-butyl-2-[(3,4-difluorobenzoyl)amino]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155559224 |
| Molecular Formula | C19H18F2N4O2 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | N-butyl-2-[(3,4-difluorobenzoyl)amino]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCCCNC(=O)c1c(NC(=O)c2ccc(F)c(F)c2)nc2ccccn12 |
| InChI | InChI=1S/C19H18F2N4O2/c1-2-3-9-22-19(27)16-17(23-15-6-4-5-10-25(15)16)24-18(26)12-7-8-13(20)14(21)11-12/h4-8,10-11H,2-3,9H2,1H3,(H,22,27)(H,24,26) |
| InChIKey | ILLNVTOHNVMYAG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|