About CID 155559311
CID 155559311 (PubChem CID 155559311) has the molecular formula C33H34ClFN7O3
and a molecular weight of 631.13 g/mol.
Molecular Properties
| Compound Name | CID 155559311 |
| PubChem CID | 155559311 |
| Molecular Formula | C33H34ClFN7O3 |
| Molecular Weight | 631.13 g/mol |
| Exact Mass | 630.24 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(NC(=O)c2ccc(Nc3ncc(F)c(Nc4ccc(C(=O)Nc5ccccc5Cl)cc4)n3)cc2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C33H34ClFN7O3/c1-32(2)17-24(18-33(3,4)42(32)45)38-29(43)20-11-15-23(16-12-20)39-31-36-19-26(35)28(41-31)37-22-13-9-21(10-14-22)30(44)40-27-8-6-5-7-25(27)34/h5-16,19,24H,17-18H2,1-4H3,(H,38,43)(H,40,44)(H2,36,37,39,41) |
| InChIKey | SLYMRFHIVVKAEL-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 131.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 631.13 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 155559311 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155559311?
The IUPAC name of CID 155559311 (CID 155559311) is not available.
What is the SMILES notation for CID 155559311?
The canonical SMILES for CID 155559311 is CC1(C)CC(NC(=O)c2ccc(Nc3ncc(F)c(Nc4ccc(C(=O)Nc5ccccc5Cl)cc4)n3)cc2)CC(C)(C)N1[O].
What is the InChIKey of CID 155559311?
The InChIKey is SLYMRFHIVVKAEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H34ClFN7O3/c1-32(2)17-24(18-33(3,4)42(32)45)38-29(43)20-11-15-23(16-12-20)39-31-36-19-26(35)28(41-31)37-22-13-9-21(10-14-22)30(44)40-27-8-6-5-7-25(27)34/h5-16,19,24H,17-18H2,1-4H3,(H,38,43)(H,40,44)(H2,36,37,39,41).
What are the key properties of CID 155559311?
CID 155559311 has a molecular weight of 631.13 g/mol, XLogP of 7.11, 8 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155559311 is sourced from PubChem (CID 155559311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).