C31H36N10O3 — CID 155559509
1-[(3S)-3-[[2-[4-(4-acetylpiperazin-1-yl)anilino]-5-[6-(methylamino)pyrazin-2-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]piperidin-1-yl]prop-2-en-1-one (PubChem CID 155559509) has the molecular formula C31H36N10O3 and a molecular weight of 596.70 g/mol. Its IUPAC name is 1-[(3S)-3-[[2-[4-(4-acetylpiperazin-1-yl)anilino]-5-[6-(methylamino)pyrazin-2-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3S)-3-[[2-[4-(4-acetylpiperazin-1-yl)anilino]-5-[6-(methylamino)pyrazin-2-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155559509 |
| Molecular Formula | C31H36N10O3 |
| Molecular Weight | 596.70 g/mol |
| Exact Mass | 596.30 |
| IUPAC Name | 1-[(3S)-3-[[2-[4-(4-acetylpiperazin-1-yl)anilino]-5-[6-(methylamino)pyrazin-2-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC[C@H](Oc2nc(Nc3ccc(N4CCN(C(C)=O)CC4)cc3)nc3[nH]cc(-c4cncc(NC)n4)c23)C1 |
| InChI | InChI=1S/C31H36N10O3/c1-4-27(43)41-11-5-6-23(19-41)44-30-28-24(25-17-33-18-26(32-3)36-25)16-34-29(28)37-31(38-30)35-21-7-9-22(10-8-21)40-14-12-39(13-15-40)20(2)42/h4,7-10,16-18,23H,1,5-6,11-15,19H2,2-3H3,(H,32,36)(H2,34,35,37,38)/t23-/m0/s1 |
| InChIKey | WPDQGDJJVZFPTQ-QHCPKHFHSA-N |
| XLogP | 3.42 |
| TPSA | 144.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.70 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|