C21H39N3O3 — CID 155559528
N-[[(3S,4S)-6,6-dibutyl-3-methoxy-3-methyldioxan-4-yl]methyl]-3-imidazol-1-ylpropan-1-amine (PubChem CID 155559528) has the molecular formula C21H39N3O3 and a molecular weight of 381.56 g/mol. Its IUPAC name is N-[[(3S,4S)-6,6-dibutyl-3-methoxy-3-methyldioxan-4-yl]methyl]-3-imidazol-1-ylpropan-1-amine.
| Compound Name | N-[[(3S,4S)-6,6-dibutyl-3-methoxy-3-methyldioxan-4-yl]methyl]-3-imidazol-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 155559528 |
| Molecular Formula | C21H39N3O3 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.30 |
| IUPAC Name | N-[[(3S,4S)-6,6-dibutyl-3-methoxy-3-methyldioxan-4-yl]methyl]-3-imidazol-1-ylpropan-1-amine |
| SMILES | CCCCC1(CCCC)C[C@@H](CNCCCn2ccnc2)[C@@](C)(OC)OO1 |
| InChI | InChI=1S/C21H39N3O3/c1-5-7-10-21(11-8-6-2)16-19(20(3,25-4)26-27-21)17-22-12-9-14-24-15-13-23-18-24/h13,15,18-19,22H,5-12,14,16-17H2,1-4H3/t19-,20-/m0/s1 |
| InChIKey | ZRJTUXPFSLFBIV-PMACEKPBSA-N |
| XLogP | 4.31 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|