C17H14N6O — CID 155559636
8-amino-6-(4-aminophenyl)-2-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-3-one (PubChem CID 155559636) has the molecular formula C17H14N6O and a molecular weight of 318.34 g/mol. Its IUPAC name is 8-amino-6-(4-aminophenyl)-2-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-3-one.
| Compound Name | 8-amino-6-(4-aminophenyl)-2-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
|---|---|
| PubChem CID | 155559636 |
| Molecular Formula | C17H14N6O |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 8-amino-6-(4-aminophenyl)-2-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
| SMILES | Nc1ccc(-c2cn3c(=O)n(-c4ccccc4)nc3c(N)n2)cc1 |
| InChI | InChI=1S/C17H14N6O/c18-12-8-6-11(7-9-12)14-10-22-16(15(19)20-14)21-23(17(22)24)13-4-2-1-3-5-13/h1-10H,18H2,(H2,19,20) |
| InChIKey | USBWTMHHGYJVJX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 104.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|