About 4-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]pyridine
4-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]pyridine (PubChem CID 155559779) has the molecular formula C21H16F3N3O2
and a molecular weight of 399.37 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]pyridine.
Molecular Properties
| Compound Name | 4-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]pyridine |
| PubChem CID | 155559779 |
| Molecular Formula | C21H16F3N3O2 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]pyridine |
| SMILES | COc1ccc(-c2nccc3[nH]nc(-c4cccc(C(F)(F)F)c4)c23)cc1OC |
| InChI | InChI=1S/C21H16F3N3O2/c1-28-16-7-6-13(11-17(16)29-2)19-18-15(8-9-25-19)26-27-20(18)12-4-3-5-14(10-12)21(22,23)24/h3-11H,1-2H3,(H,26,27) |
| InChIKey | SOPVLNIVIQXVII-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]pyridine?
The IUPAC name of 4-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]pyridine (CID 155559779) is 4-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]pyridine.
What is the SMILES notation for 4-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]pyridine?
The canonical SMILES for 4-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]pyridine is COc1ccc(-c2nccc3[nH]nc(-c4cccc(C(F)(F)F)c4)c23)cc1OC.
What is the InChIKey of 4-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]pyridine?
The InChIKey is SOPVLNIVIQXVII-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16F3N3O2/c1-28-16-7-6-13(11-17(16)29-2)19-18-15(8-9-25-19)26-27-20(18)12-4-3-5-14(10-12)21(22,23)24/h3-11H,1-2H3,(H,26,27).
What are the key properties of 4-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]pyridine?
4-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]pyridine has a molecular weight of 399.37 g/mol, XLogP of 5.33, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]-1H-pyrazolo[4,3-c]pyridine is sourced from PubChem (CID 155559779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).