C30H38N4O7 — CID 155559818
ethyl (4R)-4-[[(2S)-2-[(2-hydroxy-4-oxo-4-pyridin-4-ylbutanoyl)amino]-3-phenylpropanoyl]amino]-5-[(3S)-2-oxopiperidin-3-yl]pentanoate (PubChem CID 155559818) has the molecular formula C30H38N4O7 and a molecular weight of 566.66 g/mol. Its IUPAC name is ethyl (4R)-4-[[(2S)-2-[(2-hydroxy-4-oxo-4-pyridin-4-ylbutanoyl)amino]-3-phenylpropanoyl]amino]-5-[(3S)-2-oxopiperidin-3-yl]pentanoate.
| Compound Name | ethyl (4R)-4-[[(2S)-2-[(2-hydroxy-4-oxo-4-pyridin-4-ylbutanoyl)amino]-3-phenylpropanoyl]amino]-5-[(3S)-2-oxopiperidin-3-yl]pentanoate |
|---|---|
| PubChem CID | 155559818 |
| Molecular Formula | C30H38N4O7 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | ethyl (4R)-4-[[(2S)-2-[(2-hydroxy-4-oxo-4-pyridin-4-ylbutanoyl)amino]-3-phenylpropanoyl]amino]-5-[(3S)-2-oxopiperidin-3-yl]pentanoate |
| SMILES | CCOC(=O)CC[C@H](C[C@@H]1CCCNC1=O)NC(=O)[C@H](Cc1ccccc1)NC(=O)C(O)CC(=O)c1ccncc1 |
| InChI | InChI=1S/C30H38N4O7/c1-2-41-27(37)11-10-23(18-22-9-6-14-32-28(22)38)33-29(39)24(17-20-7-4-3-5-8-20)34-30(40)26(36)19-25(35)21-12-15-31-16-13-21/h3-5,7-8,12-13,15-16,22-24,26,36H,2,6,9-11,14,17-19H2,1H3,(H,32,38)(H,33,39)(H,34,40)/t22-,23+,24-,26?/m0/s1 |
| InChIKey | WGQLTPDIKHWLNL-YGZCJARRSA-N |
| XLogP | 1.49 |
| TPSA | 163.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |