C13H22O5 — CID 155559820
(4R,5S,6S)-5-hydroxy-6-[(Z,3S)-3-hydroxyhept-1-enyl]-4-methoxyoxan-2-one (PubChem CID 155559820) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is (4R,5S,6S)-5-hydroxy-6-[(Z,3S)-3-hydroxyhept-1-enyl]-4-methoxyoxan-2-one.
| Compound Name | (4R,5S,6S)-5-hydroxy-6-[(Z,3S)-3-hydroxyhept-1-enyl]-4-methoxyoxan-2-one |
|---|---|
| PubChem CID | 155559820 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | (4R,5S,6S)-5-hydroxy-6-[(Z,3S)-3-hydroxyhept-1-enyl]-4-methoxyoxan-2-one |
| SMILES | CCCC[C@H](O)/C=C\[C@@H]1OC(=O)C[C@@H](OC)[C@@H]1O |
| InChI | InChI=1S/C13H22O5/c1-3-4-5-9(14)6-7-10-13(16)11(17-2)8-12(15)18-10/h6-7,9-11,13-14,16H,3-5,8H2,1-2H3/b7-6-/t9-,10-,11+,13+/m0/s1 |
| InChIKey | KXEFVNKKOIKTBX-VHUUAQPOSA-N |
| XLogP | 0.79 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|