About [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate
[(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 155559882) has the molecular formula C22H21F3O5
and a molecular weight of 422.40 g/mol. Its IUPAC name is [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
Molecular Properties
| Compound Name | [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| PubChem CID | 155559882 |
| Molecular Formula | C22H21F3O5 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | COc1cc(OC)c(OC)cc1/C=C/COC(=O)/C=C/c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H21F3O5/c1-27-18-14-20(29-3)19(28-2)13-16(18)7-5-11-30-21(26)10-9-15-6-4-8-17(12-15)22(23,24)25/h4-10,12-14H,11H2,1-3H3/b7-5+,10-9+ |
| InChIKey | WGQMXIIVQMVBDH-GLVZAGOZSA-N |
| XLogP | 5.00 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate?
The IUPAC name of [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate (CID 155559882) is [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
What is the SMILES notation for [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate?
The canonical SMILES for [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate is COc1cc(OC)c(OC)cc1/C=C/COC(=O)/C=C/c1cccc(C(F)(F)F)c1.
What is the InChIKey of [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate?
The InChIKey is WGQMXIIVQMVBDH-GLVZAGOZSA-N. The full InChI is InChI=1S/C22H21F3O5/c1-27-18-14-20(29-3)19(28-2)13-16(18)7-5-11-30-21(26)10-9-15-6-4-8-17(12-15)22(23,24)25/h4-10,12-14H,11H2,1-3H3/b7-5+,10-9+.
What are the key properties of [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate?
[(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate has a molecular weight of 422.40 g/mol, XLogP of 5.00, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate is sourced from PubChem (CID 155559882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).