C13H11N5O3S — CID 155559950
5-methyl-2-[(3-nitrophenyl)methylsulfanyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 155559950) has the molecular formula C13H11N5O3S and a molecular weight of 317.33 g/mol. Its IUPAC name is 5-methyl-2-[(3-nitrophenyl)methylsulfanyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 5-methyl-2-[(3-nitrophenyl)methylsulfanyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 155559950 |
| Molecular Formula | C13H11N5O3S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 5-methyl-2-[(3-nitrophenyl)methylsulfanyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cc1cc(=O)n2[nH]c(SCc3cccc([N+](=O)[O-])c3)nc2n1 |
| InChI | InChI=1S/C13H11N5O3S/c1-8-5-11(19)17-12(14-8)15-13(16-17)22-7-9-3-2-4-10(6-9)18(20)21/h2-6H,7H2,1H3,(H,14,15,16) |
| InChIKey | XZGHBUBWVBSIGX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|