C15H24O2 — CID 155559985
(4S,4aS,5Z,7S,8S)-4,4a,6-trimethyl-3,4,7,8,9,10-hexahydro-2H-benzo[8]annulene-7,8-diol (PubChem CID 155559985) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (4S,4aS,5Z,7S,8S)-4,4a,6-trimethyl-3,4,7,8,9,10-hexahydro-2H-benzo[8]annulene-7,8-diol.
| Compound Name | (4S,4aS,5Z,7S,8S)-4,4a,6-trimethyl-3,4,7,8,9,10-hexahydro-2H-benzo[8]annulene-7,8-diol |
|---|---|
| PubChem CID | 155559985 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (4S,4aS,5Z,7S,8S)-4,4a,6-trimethyl-3,4,7,8,9,10-hexahydro-2H-benzo[8]annulene-7,8-diol |
| SMILES | C/C1=C/[C@@]2(C)C(=CCC[C@@H]2C)CC[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H24O2/c1-10-9-15(3)11(2)5-4-6-12(15)7-8-13(16)14(10)17/h6,9,11,13-14,16-17H,4-5,7-8H2,1-3H3/b10-9-/t11-,13-,14-,15+/m0/s1 |
| InChIKey | CSNFIYPQPZDSOX-XEFQAAGKSA-N |
| XLogP | 2.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|