About 6-[(2-aminocyclohexyl)amino]-8-(3-methylanilino)-2H-2,7-naphthyridin-1-one
6-[(2-aminocyclohexyl)amino]-8-(3-methylanilino)-2H-2,7-naphthyridin-1-one (PubChem CID 155560050) has the molecular formula C21H25N5O
and a molecular weight of 363.47 g/mol. Its IUPAC name is 6-[(2-aminocyclohexyl)amino]-8-(3-methylanilino)-2H-2,7-naphthyridin-1-one.
Molecular Properties
| Compound Name | 6-[(2-aminocyclohexyl)amino]-8-(3-methylanilino)-2H-2,7-naphthyridin-1-one |
| PubChem CID | 155560050 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 6-[(2-aminocyclohexyl)amino]-8-(3-methylanilino)-2H-2,7-naphthyridin-1-one |
| SMILES | Cc1cccc(Nc2nc(NC3CCCCC3N)cc3cc[nH]c(=O)c23)c1 |
| InChI | InChI=1S/C21H25N5O/c1-13-5-4-6-15(11-13)24-20-19-14(9-10-23-21(19)27)12-18(26-20)25-17-8-3-2-7-16(17)22/h4-6,9-12,16-17H,2-3,7-8,22H2,1H3,(H,23,27)(H2,24,25,26) |
| InChIKey | VGCGSJJJHOPEEF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[(2-aminocyclohexyl)amino]-8-(3-methylanilino)-2H-2,7-naphthyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2-aminocyclohexyl)amino]-8-(3-methylanilino)-2H-2,7-naphthyridin-1-one?
The IUPAC name of 6-[(2-aminocyclohexyl)amino]-8-(3-methylanilino)-2H-2,7-naphthyridin-1-one (CID 155560050) is 6-[(2-aminocyclohexyl)amino]-8-(3-methylanilino)-2H-2,7-naphthyridin-1-one.
What is the SMILES notation for 6-[(2-aminocyclohexyl)amino]-8-(3-methylanilino)-2H-2,7-naphthyridin-1-one?
The canonical SMILES for 6-[(2-aminocyclohexyl)amino]-8-(3-methylanilino)-2H-2,7-naphthyridin-1-one is Cc1cccc(Nc2nc(NC3CCCCC3N)cc3cc[nH]c(=O)c23)c1.
What is the InChIKey of 6-[(2-aminocyclohexyl)amino]-8-(3-methylanilino)-2H-2,7-naphthyridin-1-one?
The InChIKey is VGCGSJJJHOPEEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N5O/c1-13-5-4-6-15(11-13)24-20-19-14(9-10-23-21(19)27)12-18(26-20)25-17-8-3-2-7-16(17)22/h4-6,9-12,16-17H,2-3,7-8,22H2,1H3,(H,23,27)(H2,24,25,26).
What are the key properties of 6-[(2-aminocyclohexyl)amino]-8-(3-methylanilino)-2H-2,7-naphthyridin-1-one?
6-[(2-aminocyclohexyl)amino]-8-(3-methylanilino)-2H-2,7-naphthyridin-1-one has a molecular weight of 363.47 g/mol, XLogP of 3.66, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2-aminocyclohexyl)amino]-8-(3-methylanilino)-2H-2,7-naphthyridin-1-one is sourced from PubChem (CID 155560050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).