C22H29N3O3 — CID 155560190
N-[[(4aR,8aR)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyran-4a-yl]methyl]-3-(2-aminoquinolin-3-yl)-2-methylpropanamide (PubChem CID 155560190) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is N-[[(4aR,8aR)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyran-4a-yl]methyl]-3-(2-aminoquinolin-3-yl)-2-methylpropanamide.
| Compound Name | N-[[(4aR,8aR)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyran-4a-yl]methyl]-3-(2-aminoquinolin-3-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 155560190 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | N-[[(4aR,8aR)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyran-4a-yl]methyl]-3-(2-aminoquinolin-3-yl)-2-methylpropanamide |
| SMILES | CC(Cc1cc2ccccc2nc1N)C(=O)NC[C@@]12CCCO[C@@H]1CCOC2 |
| InChI | InChI=1S/C22H29N3O3/c1-15(11-17-12-16-5-2-3-6-18(16)25-20(17)23)21(26)24-13-22-8-4-9-28-19(22)7-10-27-14-22/h2-3,5-6,12,15,19H,4,7-11,13-14H2,1H3,(H2,23,25)(H,24,26)/t15?,19-,22-/m1/s1 |
| InChIKey | PHKAPBRNTVXSDM-ZGELDQQJSA-N |
| XLogP | 2.70 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |