About [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-[4-(2-methylpropyl)phenyl]propanoate
[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-[4-(2-methylpropyl)phenyl]propanoate (PubChem CID 155560269) has the molecular formula C19H26O4
and a molecular weight of 318.41 g/mol. Its IUPAC name is [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-[4-(2-methylpropyl)phenyl]propanoate.
Molecular Properties
| Compound Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-[4-(2-methylpropyl)phenyl]propanoate |
| PubChem CID | 155560269 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-[4-(2-methylpropyl)phenyl]propanoate |
| SMILES | CC(C)Cc1ccc(C(C)C(=O)O[C@H]2C(=O)OCC2(C)C)cc1 |
| InChI | InChI=1S/C19H26O4/c1-12(2)10-14-6-8-15(9-7-14)13(3)17(20)23-16-18(21)22-11-19(16,4)5/h6-9,12-13,16H,10-11H2,1-5H3/t13?,16-/m0/s1 |
| InChIKey | OLCFYKWONGCGSI-VYIIXAMBSA-N |
| XLogP | 3.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-[4-(2-methylpropyl)phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-[4-(2-methylpropyl)phenyl]propanoate?
The IUPAC name of [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-[4-(2-methylpropyl)phenyl]propanoate (CID 155560269) is [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-[4-(2-methylpropyl)phenyl]propanoate.
What is the SMILES notation for [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-[4-(2-methylpropyl)phenyl]propanoate?
The canonical SMILES for [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-[4-(2-methylpropyl)phenyl]propanoate is CC(C)Cc1ccc(C(C)C(=O)O[C@H]2C(=O)OCC2(C)C)cc1.
What is the InChIKey of [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-[4-(2-methylpropyl)phenyl]propanoate?
The InChIKey is OLCFYKWONGCGSI-VYIIXAMBSA-N. The full InChI is InChI=1S/C19H26O4/c1-12(2)10-14-6-8-15(9-7-14)13(3)17(20)23-16-18(21)22-11-19(16,4)5/h6-9,12-13,16H,10-11H2,1-5H3/t13?,16-/m0/s1.
What are the key properties of [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-[4-(2-methylpropyl)phenyl]propanoate?
[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-[4-(2-methylpropyl)phenyl]propanoate has a molecular weight of 318.41 g/mol, XLogP of 3.48, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-[4-(2-methylpropyl)phenyl]propanoate is sourced from PubChem (CID 155560269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).