C34H42N4O6 — CID 155560271
(3S,6S,9S,13R)-3,6-dibenzyl-9-[6-[(2S)-oxiran-2-yl]-6-oxohexyl]-1,4,7,10-tetrazabicyclo[11.3.0]hexadecane-2,5,8,11-tetrone (PubChem CID 155560271) has the molecular formula C34H42N4O6 and a molecular weight of 602.73 g/mol. Its IUPAC name is (3S,6S,9S,13R)-3,6-dibenzyl-9-[6-[(2S)-oxiran-2-yl]-6-oxohexyl]-1,4,7,10-tetrazabicyclo[11.3.0]hexadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9S,13R)-3,6-dibenzyl-9-[6-[(2S)-oxiran-2-yl]-6-oxohexyl]-1,4,7,10-tetrazabicyclo[11.3.0]hexadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 155560271 |
| Molecular Formula | C34H42N4O6 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.31 |
| IUPAC Name | (3S,6S,9S,13R)-3,6-dibenzyl-9-[6-[(2S)-oxiran-2-yl]-6-oxohexyl]-1,4,7,10-tetrazabicyclo[11.3.0]hexadecane-2,5,8,11-tetrone |
| SMILES | O=C1C[C@H]2CCCN2C(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](CCCCCC(=O)[C@@H]2CO2)N1 |
| InChI | InChI=1S/C34H42N4O6/c39-29(30-22-44-30)17-9-3-8-16-26-32(41)36-27(19-23-11-4-1-5-12-23)33(42)37-28(20-24-13-6-2-7-14-24)34(43)38-18-10-15-25(38)21-31(40)35-26/h1-2,4-7,11-14,25-28,30H,3,8-10,15-22H2,(H,35,40)(H,36,41)(H,37,42)/t25-,26+,27+,28+,30+/m1/s1 |
| InChIKey | TUJYSRGFWBQJNM-QUBFWBSFSA-N |
| XLogP | 2.24 |
| TPSA | 137.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|