C31H45N5O2 — CID 155560401
7-methoxy-2-phenyl-N-(1-propan-2-ylpiperidin-4-yl)-8-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydro-1H-1,4-benzodiazepin-5-amine (PubChem CID 155560401) has the molecular formula C31H45N5O2 and a molecular weight of 519.73 g/mol. Its IUPAC name is 7-methoxy-2-phenyl-N-(1-propan-2-ylpiperidin-4-yl)-8-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydro-1H-1,4-benzodiazepin-5-amine.
| Compound Name | 7-methoxy-2-phenyl-N-(1-propan-2-ylpiperidin-4-yl)-8-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydro-1H-1,4-benzodiazepin-5-amine |
|---|---|
| PubChem CID | 155560401 |
| Molecular Formula | C31H45N5O2 |
| Molecular Weight | 519.73 g/mol |
| Exact Mass | 519.36 |
| IUPAC Name | 7-methoxy-2-phenyl-N-(1-propan-2-ylpiperidin-4-yl)-8-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydro-1H-1,4-benzodiazepin-5-amine |
| SMILES | COc1cc2c(cc1OCCCN1CCCC1)NC(c1ccccc1)CN=C2NC1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C31H45N5O2/c1-23(2)36-17-12-25(13-18-36)33-31-26-20-29(37-3)30(38-19-9-16-35-14-7-8-15-35)21-27(26)34-28(22-32-31)24-10-5-4-6-11-24/h4-6,10-11,20-21,23,25,28,34H,7-9,12-19,22H2,1-3H3,(H,32,33) |
| InChIKey | XAEMTLINCDZKPF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.73 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|