C23H29NO5S — CID 155560515
methyl 2-[(1S,5R,8S,8aS)-3,8-dimethyl-1-[(4-methylphenyl)sulfonylamino]-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoate (PubChem CID 155560515) has the molecular formula C23H29NO5S and a molecular weight of 431.55 g/mol. Its IUPAC name is methyl 2-[(1S,5R,8S,8aS)-3,8-dimethyl-1-[(4-methylphenyl)sulfonylamino]-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoate.
| Compound Name | methyl 2-[(1S,5R,8S,8aS)-3,8-dimethyl-1-[(4-methylphenyl)sulfonylamino]-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 155560515 |
| Molecular Formula | C23H29NO5S |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | methyl 2-[(1S,5R,8S,8aS)-3,8-dimethyl-1-[(4-methylphenyl)sulfonylamino]-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1CC[C@H](C)[C@H]2C(=C(C)C(=O)[C@H]2NS(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C23H29NO5S/c1-13-6-10-18(11-7-13)30(27,28)24-21-20-14(2)8-9-17(15(3)23(26)29-5)12-19(20)16(4)22(21)25/h6-7,10-11,14,17,20-21,24H,3,8-9,12H2,1-2,4-5H3/t14-,17+,20-,21-/m0/s1 |
| InChIKey | DJIUREPIUWEGCF-ITNCUTESSA-N |
| XLogP | 3.32 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|