C31H29ClN4O — CID 155560640
(3E,5E)-1-[[1-[(2-chlorophenyl)methyl]triazol-4-yl]methyl]-3,5-bis[(4-methylphenyl)methylidene]piperidin-4-one (PubChem CID 155560640) has the molecular formula C31H29ClN4O and a molecular weight of 509.05 g/mol. Its IUPAC name is (3E,5E)-1-[[1-[(2-chlorophenyl)methyl]triazol-4-yl]methyl]-3,5-bis[(4-methylphenyl)methylidene]piperidin-4-one.
| Compound Name | (3E,5E)-1-[[1-[(2-chlorophenyl)methyl]triazol-4-yl]methyl]-3,5-bis[(4-methylphenyl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 155560640 |
| Molecular Formula | C31H29ClN4O |
| Molecular Weight | 509.05 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | (3E,5E)-1-[[1-[(2-chlorophenyl)methyl]triazol-4-yl]methyl]-3,5-bis[(4-methylphenyl)methylidene]piperidin-4-one |
| SMILES | Cc1ccc(/C=C2\CN(Cc3cn(Cc4ccccc4Cl)nn3)C/C(=C\c3ccc(C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C31H29ClN4O/c1-22-7-11-24(12-8-22)15-27-17-35(18-28(31(27)37)16-25-13-9-23(2)10-14-25)20-29-21-36(34-33-29)19-26-5-3-4-6-30(26)32/h3-16,21H,17-20H2,1-2H3/b27-15+,28-16+ |
| InChIKey | DXGVAZNBBVFQGH-DPCVLPDWSA-N |
| XLogP | 6.15 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.05 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|