C22H25FN4O2 — CID 155560722
3-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-5-phenyl-1,3,4-oxadiazol-2-one (PubChem CID 155560722) has the molecular formula C22H25FN4O2 and a molecular weight of 396.47 g/mol. Its IUPAC name is 3-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-5-phenyl-1,3,4-oxadiazol-2-one.
| Compound Name | 3-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-5-phenyl-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 155560722 |
| Molecular Formula | C22H25FN4O2 |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 3-[4-[4-(4-fluorophenyl)piperazin-1-yl]butyl]-5-phenyl-1,3,4-oxadiazol-2-one |
| SMILES | O=c1oc(-c2ccccc2)nn1CCCCN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H25FN4O2/c23-19-8-10-20(11-9-19)26-16-14-25(15-17-26)12-4-5-13-27-22(28)29-21(24-27)18-6-2-1-3-7-18/h1-3,6-11H,4-5,12-17H2 |
| InChIKey | IOAXVKXNLDSFFC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 54.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|