C26H28N4O3 — CID 155560768
4-[3-[4-(7-methoxyisoquinolin-1-yl)piperazin-1-yl]propylamino]chromen-2-one (PubChem CID 155560768) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is 4-[3-[4-(7-methoxyisoquinolin-1-yl)piperazin-1-yl]propylamino]chromen-2-one.
| Compound Name | 4-[3-[4-(7-methoxyisoquinolin-1-yl)piperazin-1-yl]propylamino]chromen-2-one |
|---|---|
| PubChem CID | 155560768 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 4-[3-[4-(7-methoxyisoquinolin-1-yl)piperazin-1-yl]propylamino]chromen-2-one |
| SMILES | COc1ccc2ccnc(N3CCN(CCCNc4cc(=O)oc5ccccc45)CC3)c2c1 |
| InChI | InChI=1S/C26H28N4O3/c1-32-20-8-7-19-9-11-28-26(22(19)17-20)30-15-13-29(14-16-30)12-4-10-27-23-18-25(31)33-24-6-3-2-5-21(23)24/h2-3,5-9,11,17-18,27H,4,10,12-16H2,1H3 |
| InChIKey | YLKRJZMQGDSHIU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|