C24H28O5 — CID 155560813
[(7S)-3-ethenyl-7-methyl-6,8-dioxoisochromen-7-yl] (2E,4E,6S)-4,6-dimethyldeca-2,4-dienoate (PubChem CID 155560813) has the molecular formula C24H28O5 and a molecular weight of 396.48 g/mol. Its IUPAC name is [(7S)-3-ethenyl-7-methyl-6,8-dioxoisochromen-7-yl] (2E,4E,6S)-4,6-dimethyldeca-2,4-dienoate.
| Compound Name | [(7S)-3-ethenyl-7-methyl-6,8-dioxoisochromen-7-yl] (2E,4E,6S)-4,6-dimethyldeca-2,4-dienoate |
|---|---|
| PubChem CID | 155560813 |
| Molecular Formula | C24H28O5 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | [(7S)-3-ethenyl-7-methyl-6,8-dioxoisochromen-7-yl] (2E,4E,6S)-4,6-dimethyldeca-2,4-dienoate |
| SMILES | C=CC1=CC2=CC(=O)[C@](C)(OC(=O)/C=C/C(C)=C/[C@@H](C)CCCC)C(=O)C2=CO1 |
| InChI | InChI=1S/C24H28O5/c1-6-8-9-16(3)12-17(4)10-11-22(26)29-24(5)21(25)14-18-13-19(7-2)28-15-20(18)23(24)27/h7,10-16H,2,6,8-9H2,1,3-5H3/b11-10+,17-12+/t16-,24-/m0/s1 |
| InChIKey | WZBURYXQJPVWJJ-WTSACNSVSA-N |
| XLogP | 4.68 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|