C23H29FN4O3S — CID 155561045
1-[4-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-pyridin-4-ylthiazinan-2-yl]methyl]phenyl]piperazin-1-yl]ethanone (PubChem CID 155561045) has the molecular formula C23H29FN4O3S and a molecular weight of 460.58 g/mol. Its IUPAC name is 1-[4-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-pyridin-4-ylthiazinan-2-yl]methyl]phenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-pyridin-4-ylthiazinan-2-yl]methyl]phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 155561045 |
| Molecular Formula | C23H29FN4O3S |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 1-[4-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-pyridin-4-ylthiazinan-2-yl]methyl]phenyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ccc(CN3[C@@H](C)CC[C@H](c4ccncc4)S3(=O)=O)c(F)c2)CC1 |
| InChI | InChI=1S/C23H29FN4O3S/c1-17-3-6-23(19-7-9-25-10-8-19)32(30,31)28(17)16-20-4-5-21(15-22(20)24)27-13-11-26(12-14-27)18(2)29/h4-5,7-10,15,17,23H,3,6,11-14,16H2,1-2H3/t17-,23+/m0/s1 |
| InChIKey | LJNSCTQZFSUEAL-GAJHUEQPSA-N |
| XLogP | 2.94 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|