About N-hydroxy-2-pentyl-1,2,4-triazole-3-carboxamide
N-hydroxy-2-pentyl-1,2,4-triazole-3-carboxamide (PubChem CID 155561111) has the molecular formula C8H14N4O2
and a molecular weight of 198.23 g/mol. Its IUPAC name is N-hydroxy-2-pentyl-1,2,4-triazole-3-carboxamide.
Molecular Properties
| Compound Name | N-hydroxy-2-pentyl-1,2,4-triazole-3-carboxamide |
| PubChem CID | 155561111 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | N-hydroxy-2-pentyl-1,2,4-triazole-3-carboxamide |
| SMILES | CCCCCn1ncnc1C(=O)NO |
| InChI | InChI=1S/C8H14N4O2/c1-2-3-4-5-12-7(8(13)11-14)9-6-10-12/h6,14H,2-5H2,1H3,(H,11,13) |
| InChIKey | CIFNSPZFPCLOPP-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-2-pentyl-1,2,4-triazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-2-pentyl-1,2,4-triazole-3-carboxamide?
The IUPAC name of N-hydroxy-2-pentyl-1,2,4-triazole-3-carboxamide (CID 155561111) is N-hydroxy-2-pentyl-1,2,4-triazole-3-carboxamide.
What is the SMILES notation for N-hydroxy-2-pentyl-1,2,4-triazole-3-carboxamide?
The canonical SMILES for N-hydroxy-2-pentyl-1,2,4-triazole-3-carboxamide is CCCCCn1ncnc1C(=O)NO.
What is the InChIKey of N-hydroxy-2-pentyl-1,2,4-triazole-3-carboxamide?
The InChIKey is CIFNSPZFPCLOPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O2/c1-2-3-4-5-12-7(8(13)11-14)9-6-10-12/h6,14H,2-5H2,1H3,(H,11,13).
What are the key properties of N-hydroxy-2-pentyl-1,2,4-triazole-3-carboxamide?
N-hydroxy-2-pentyl-1,2,4-triazole-3-carboxamide has a molecular weight of 198.23 g/mol, XLogP of 0.59, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-2-pentyl-1,2,4-triazole-3-carboxamide is sourced from PubChem (CID 155561111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).