About 6-(1,3-benzodioxol-5-yl)-1-methyl-N-phenylimidazo[4,5-c]pyridin-2-amine
6-(1,3-benzodioxol-5-yl)-1-methyl-N-phenylimidazo[4,5-c]pyridin-2-amine (PubChem CID 155561137) has the molecular formula C20H16N4O2
and a molecular weight of 344.37 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-yl)-1-methyl-N-phenylimidazo[4,5-c]pyridin-2-amine.
Molecular Properties
| Compound Name | 6-(1,3-benzodioxol-5-yl)-1-methyl-N-phenylimidazo[4,5-c]pyridin-2-amine |
| PubChem CID | 155561137 |
| Molecular Formula | C20H16N4O2 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 6-(1,3-benzodioxol-5-yl)-1-methyl-N-phenylimidazo[4,5-c]pyridin-2-amine |
| SMILES | Cn1c(Nc2ccccc2)nc2cnc(-c3ccc4c(c3)OCO4)cc21 |
| InChI | InChI=1S/C20H16N4O2/c1-24-17-10-15(13-7-8-18-19(9-13)26-12-25-18)21-11-16(17)23-20(24)22-14-5-3-2-4-6-14/h2-11H,12H2,1H3,(H,22,23) |
| InChIKey | GEWGYSFRGRXTNZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(1,3-benzodioxol-5-yl)-1-methyl-N-phenylimidazo[4,5-c]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,3-benzodioxol-5-yl)-1-methyl-N-phenylimidazo[4,5-c]pyridin-2-amine?
The IUPAC name of 6-(1,3-benzodioxol-5-yl)-1-methyl-N-phenylimidazo[4,5-c]pyridin-2-amine (CID 155561137) is 6-(1,3-benzodioxol-5-yl)-1-methyl-N-phenylimidazo[4,5-c]pyridin-2-amine.
What is the SMILES notation for 6-(1,3-benzodioxol-5-yl)-1-methyl-N-phenylimidazo[4,5-c]pyridin-2-amine?
The canonical SMILES for 6-(1,3-benzodioxol-5-yl)-1-methyl-N-phenylimidazo[4,5-c]pyridin-2-amine is Cn1c(Nc2ccccc2)nc2cnc(-c3ccc4c(c3)OCO4)cc21.
What is the InChIKey of 6-(1,3-benzodioxol-5-yl)-1-methyl-N-phenylimidazo[4,5-c]pyridin-2-amine?
The InChIKey is GEWGYSFRGRXTNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N4O2/c1-24-17-10-15(13-7-8-18-19(9-13)26-12-25-18)21-11-16(17)23-20(24)22-14-5-3-2-4-6-14/h2-11H,12H2,1H3,(H,22,23).
What are the key properties of 6-(1,3-benzodioxol-5-yl)-1-methyl-N-phenylimidazo[4,5-c]pyridin-2-amine?
6-(1,3-benzodioxol-5-yl)-1-methyl-N-phenylimidazo[4,5-c]pyridin-2-amine has a molecular weight of 344.37 g/mol, XLogP of 4.11, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,3-benzodioxol-5-yl)-1-methyl-N-phenylimidazo[4,5-c]pyridin-2-amine is sourced from PubChem (CID 155561137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).