About 4-[(3-chloropyridazino[4,3-b][1,4]benzothiazin-10-yl)methyl]-N-hydroxybenzamide
4-[(3-chloropyridazino[4,3-b][1,4]benzothiazin-10-yl)methyl]-N-hydroxybenzamide (PubChem CID 155561163) has the molecular formula C18H13ClN4O2S
and a molecular weight of 384.85 g/mol. Its IUPAC name is 4-[(3-chloropyridazino[4,3-b][1,4]benzothiazin-10-yl)methyl]-N-hydroxybenzamide.
Molecular Properties
| Compound Name | 4-[(3-chloropyridazino[4,3-b][1,4]benzothiazin-10-yl)methyl]-N-hydroxybenzamide |
| PubChem CID | 155561163 |
| Molecular Formula | C18H13ClN4O2S |
| Molecular Weight | 384.85 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 4-[(3-chloropyridazino[4,3-b][1,4]benzothiazin-10-yl)methyl]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(CN2c3ccccc3Sc3cc(Cl)nnc32)cc1 |
| InChI | InChI=1S/C18H13ClN4O2S/c19-16-9-15-17(21-20-16)23(13-3-1-2-4-14(13)26-15)10-11-5-7-12(8-6-11)18(24)22-25/h1-9,25H,10H2,(H,22,24) |
| InChIKey | LCUKJODJUGZGEJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.85 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3-chloropyridazino[4,3-b][1,4]benzothiazin-10-yl)methyl]-N-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-chloropyridazino[4,3-b][1,4]benzothiazin-10-yl)methyl]-N-hydroxybenzamide?
The IUPAC name of 4-[(3-chloropyridazino[4,3-b][1,4]benzothiazin-10-yl)methyl]-N-hydroxybenzamide (CID 155561163) is 4-[(3-chloropyridazino[4,3-b][1,4]benzothiazin-10-yl)methyl]-N-hydroxybenzamide.
What is the SMILES notation for 4-[(3-chloropyridazino[4,3-b][1,4]benzothiazin-10-yl)methyl]-N-hydroxybenzamide?
The canonical SMILES for 4-[(3-chloropyridazino[4,3-b][1,4]benzothiazin-10-yl)methyl]-N-hydroxybenzamide is O=C(NO)c1ccc(CN2c3ccccc3Sc3cc(Cl)nnc32)cc1.
What is the InChIKey of 4-[(3-chloropyridazino[4,3-b][1,4]benzothiazin-10-yl)methyl]-N-hydroxybenzamide?
The InChIKey is LCUKJODJUGZGEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13ClN4O2S/c19-16-9-15-17(21-20-16)23(13-3-1-2-4-14(13)26-15)10-11-5-7-12(8-6-11)18(24)22-25/h1-9,25H,10H2,(H,22,24).
What are the key properties of 4-[(3-chloropyridazino[4,3-b][1,4]benzothiazin-10-yl)methyl]-N-hydroxybenzamide?
4-[(3-chloropyridazino[4,3-b][1,4]benzothiazin-10-yl)methyl]-N-hydroxybenzamide has a molecular weight of 384.85 g/mol, XLogP of 4.05, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-chloropyridazino[4,3-b][1,4]benzothiazin-10-yl)methyl]-N-hydroxybenzamide is sourced from PubChem (CID 155561163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).