C12H20O4 — CID 155561241
(4S,5R,6R)-4-hydroxy-6-[(E)-4-hydroxybut-2-en-2-yl]-3,3,5-trimethyloxan-2-one (PubChem CID 155561241) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is (4S,5R,6R)-4-hydroxy-6-[(E)-4-hydroxybut-2-en-2-yl]-3,3,5-trimethyloxan-2-one.
| Compound Name | (4S,5R,6R)-4-hydroxy-6-[(E)-4-hydroxybut-2-en-2-yl]-3,3,5-trimethyloxan-2-one |
|---|---|
| PubChem CID | 155561241 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (4S,5R,6R)-4-hydroxy-6-[(E)-4-hydroxybut-2-en-2-yl]-3,3,5-trimethyloxan-2-one |
| SMILES | C/C(=C\CO)[C@@H]1OC(=O)C(C)(C)[C@@H](O)[C@H]1C |
| InChI | InChI=1S/C12H20O4/c1-7(5-6-13)9-8(2)10(14)12(3,4)11(15)16-9/h5,8-10,13-14H,6H2,1-4H3/b7-5+/t8-,9-,10-/m0/s1 |
| InChIKey | YWPKCZZSHZEQGJ-IVMLVQDOSA-N |
| XLogP | 0.87 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|