C21H24FN3O3 — CID 155561381
(3R,5S)-5-[[(2E)-2-[[2-(5-fluoro-2-methoxyphenyl)phenyl]methylidene]hydrazinyl]methyl]piperidine-3-carboxylic acid (PubChem CID 155561381) has the molecular formula C21H24FN3O3 and a molecular weight of 385.44 g/mol. Its IUPAC name is (3R,5S)-5-[[(2E)-2-[[2-(5-fluoro-2-methoxyphenyl)phenyl]methylidene]hydrazinyl]methyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,5S)-5-[[(2E)-2-[[2-(5-fluoro-2-methoxyphenyl)phenyl]methylidene]hydrazinyl]methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155561381 |
| Molecular Formula | C21H24FN3O3 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | (3R,5S)-5-[[(2E)-2-[[2-(5-fluoro-2-methoxyphenyl)phenyl]methylidene]hydrazinyl]methyl]piperidine-3-carboxylic acid |
| SMILES | COc1ccc(F)cc1-c1ccccc1/C=N/NC[C@@H]1CNC[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C21H24FN3O3/c1-28-20-7-6-17(22)9-19(20)18-5-3-2-4-15(18)13-25-24-11-14-8-16(21(26)27)12-23-10-14/h2-7,9,13-14,16,23-24H,8,10-12H2,1H3,(H,26,27)/b25-13+/t14-,16+/m0/s1 |
| InChIKey | SKUDIRYZJCYERG-YZHWAHLASA-N |
| XLogP | 2.74 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|