C25H34N4O3 — CID 155561496
7,8-dimethoxy-2-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-4,5-dihydro-3H-2-benzazepin-1-one (PubChem CID 155561496) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is 7,8-dimethoxy-2-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-4,5-dihydro-3H-2-benzazepin-1-one.
| Compound Name | 7,8-dimethoxy-2-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-4,5-dihydro-3H-2-benzazepin-1-one |
|---|---|
| PubChem CID | 155561496 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | 7,8-dimethoxy-2-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-4,5-dihydro-3H-2-benzazepin-1-one |
| SMILES | COc1cc2c(cc1OC)C(=O)N(CCCCN1CCN(c3ccccn3)CC1)CCC2 |
| InChI | InChI=1S/C25H34N4O3/c1-31-22-18-20-8-7-13-29(25(30)21(20)19-23(22)32-2)12-6-5-11-27-14-16-28(17-15-27)24-9-3-4-10-26-24/h3-4,9-10,18-19H,5-8,11-17H2,1-2H3 |
| InChIKey | NZGWRTVGHIZQDX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 58.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|