C37H48O5 — CID 155561592
benzyl (1R,2S,5S,8S,10R,14S,15S,16R,18R,21R)-1,2,5,8,15,20,20-heptamethyl-13,19-dioxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-11-ene-8-carboxylate (PubChem CID 155561592) has the molecular formula C37H48O5 and a molecular weight of 572.79 g/mol. Its IUPAC name is benzyl (1R,2S,5S,8S,10R,14S,15S,16R,18R,21R)-1,2,5,8,15,20,20-heptamethyl-13,19-dioxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-11-ene-8-carboxylate.
| Compound Name | benzyl (1R,2S,5S,8S,10R,14S,15S,16R,18R,21R)-1,2,5,8,15,20,20-heptamethyl-13,19-dioxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-11-ene-8-carboxylate |
|---|---|
| PubChem CID | 155561592 |
| Molecular Formula | C37H48O5 |
| Molecular Weight | 572.79 g/mol |
| Exact Mass | 572.35 |
| IUPAC Name | benzyl (1R,2S,5S,8S,10R,14S,15S,16R,18R,21R)-1,2,5,8,15,20,20-heptamethyl-13,19-dioxo-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricos-11-ene-8-carboxylate |
| SMILES | CC1(C)C(=O)[C@@H]2O[C@@H]2[C@]2(C)[C@H]3C(=O)C=C4[C@@H]5C[C@@](C)(C(=O)OCc6ccccc6)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C37H48O5/c1-32(2)26-13-14-36(6)28(37(26,7)30-27(42-30)29(32)39)25(38)19-23-24-20-34(4,16-15-33(24,3)17-18-35(23,36)5)31(40)41-21-22-11-9-8-10-12-22/h8-12,19,24,26-28,30H,13-18,20-21H2,1-7H3/t24-,26-,27-,28-,30-,33+,34-,35+,36+,37-/m0/s1 |
| InChIKey | AUCRZUGVXXMYMU-ZXAZCWFXSA-N |
| XLogP | 7.27 |
| TPSA | 72.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.79 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|