C19H17N3O3 — CID 155561848
5-(2,5-dimethoxyphenyl)-3-(1H-indol-3-ylmethyl)-1,2,4-oxadiazole (PubChem CID 155561848) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is 5-(2,5-dimethoxyphenyl)-3-(1H-indol-3-ylmethyl)-1,2,4-oxadiazole.
| Compound Name | 5-(2,5-dimethoxyphenyl)-3-(1H-indol-3-ylmethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 155561848 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 5-(2,5-dimethoxyphenyl)-3-(1H-indol-3-ylmethyl)-1,2,4-oxadiazole |
| SMILES | COc1ccc(OC)c(-c2nc(Cc3c[nH]c4ccccc34)no2)c1 |
| InChI | InChI=1S/C19H17N3O3/c1-23-13-7-8-17(24-2)15(10-13)19-21-18(22-25-19)9-12-11-20-16-6-4-3-5-14(12)16/h3-8,10-11,20H,9H2,1-2H3 |
| InChIKey | ZQZVSPGERYLUJM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 73.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |