C26H37NO6 — CID 155561936
propan-2-yl (E,5S,6R)-5,6-dihydroxy-8-[4-[(1R)-1-hydroxyhexyl]-2-phenyl-1,3-oxazol-5-yl]oct-7-enoate (PubChem CID 155561936) has the molecular formula C26H37NO6 and a molecular weight of 459.58 g/mol. Its IUPAC name is propan-2-yl (E,5S,6R)-5,6-dihydroxy-8-[4-[(1R)-1-hydroxyhexyl]-2-phenyl-1,3-oxazol-5-yl]oct-7-enoate.
| Compound Name | propan-2-yl (E,5S,6R)-5,6-dihydroxy-8-[4-[(1R)-1-hydroxyhexyl]-2-phenyl-1,3-oxazol-5-yl]oct-7-enoate |
|---|---|
| PubChem CID | 155561936 |
| Molecular Formula | C26H37NO6 |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | propan-2-yl (E,5S,6R)-5,6-dihydroxy-8-[4-[(1R)-1-hydroxyhexyl]-2-phenyl-1,3-oxazol-5-yl]oct-7-enoate |
| SMILES | CCCCC[C@@H](O)c1nc(-c2ccccc2)oc1/C=C/[C@@H](O)[C@@H](O)CCCC(=O)OC(C)C |
| InChI | InChI=1S/C26H37NO6/c1-4-5-7-13-22(30)25-23(33-26(27-25)19-11-8-6-9-12-19)17-16-21(29)20(28)14-10-15-24(31)32-18(2)3/h6,8-9,11-12,16-18,20-22,28-30H,4-5,7,10,13-15H2,1-3H3/b17-16+/t20-,21+,22+/m0/s1 |
| InChIKey | BZWOOSQQQLYBJF-WJQFMQRSSA-N |
| XLogP | 4.81 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|