C22H10ClF5N2O4S2 — CID 155562009
6-chloro-N-[2,4-difluoro-5-[5-(2,4,5-trifluoro-3-hydroxybenzoyl)thiophen-2-yl]phenyl]pyridine-3-sulfonamide (PubChem CID 155562009) has the molecular formula C22H10ClF5N2O4S2 and a molecular weight of 560.91 g/mol. Its IUPAC name is 6-chloro-N-[2,4-difluoro-5-[5-(2,4,5-trifluoro-3-hydroxybenzoyl)thiophen-2-yl]phenyl]pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-[2,4-difluoro-5-[5-(2,4,5-trifluoro-3-hydroxybenzoyl)thiophen-2-yl]phenyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 155562009 |
| Molecular Formula | C22H10ClF5N2O4S2 |
| Molecular Weight | 560.91 g/mol |
| Exact Mass | 559.97 |
| IUPAC Name | 6-chloro-N-[2,4-difluoro-5-[5-(2,4,5-trifluoro-3-hydroxybenzoyl)thiophen-2-yl]phenyl]pyridine-3-sulfonamide |
| SMILES | O=C(c1ccc(-c2cc(NS(=O)(=O)c3ccc(Cl)nc3)c(F)cc2F)s1)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C22H10ClF5N2O4S2/c23-18-4-1-9(8-29-18)36(33,34)30-15-6-10(12(24)7-13(15)25)16-2-3-17(35-16)21(31)11-5-14(26)20(28)22(32)19(11)27/h1-8,30,32H |
| InChIKey | JKHGXFOISOLZKF-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.91 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|