C24H28N2O3S — CID 155562013
N,N-dibutyl-4-[(E)-3-(3-cyanophenyl)prop-2-enoyl]benzenesulfonamide (PubChem CID 155562013) has the molecular formula C24H28N2O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is N,N-dibutyl-4-[(E)-3-(3-cyanophenyl)prop-2-enoyl]benzenesulfonamide.
| Compound Name | N,N-dibutyl-4-[(E)-3-(3-cyanophenyl)prop-2-enoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 155562013 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | N,N-dibutyl-4-[(E)-3-(3-cyanophenyl)prop-2-enoyl]benzenesulfonamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc(C(=O)/C=C/c2cccc(C#N)c2)cc1 |
| InChI | InChI=1S/C24H28N2O3S/c1-3-5-16-26(17-6-4-2)30(28,29)23-13-11-22(12-14-23)24(27)15-10-20-8-7-9-21(18-20)19-25/h7-15,18H,3-6,16-17H2,1-2H3/b15-10+ |
| InChIKey | PZRIKWNOAQZQDI-XNTDXEJSSA-N |
| XLogP | 5.05 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|