C23H24F4N4O2S — CID 155562084
N-[(1R)-1-[5-amino-2-fluoro-3-(trifluoromethyl)phenyl]ethyl]-6-(1,1-dioxothian-4-yl)-2-methylquinazolin-4-amine (PubChem CID 155562084) has the molecular formula C23H24F4N4O2S and a molecular weight of 496.53 g/mol. Its IUPAC name is N-[(1R)-1-[5-amino-2-fluoro-3-(trifluoromethyl)phenyl]ethyl]-6-(1,1-dioxothian-4-yl)-2-methylquinazolin-4-amine.
| Compound Name | N-[(1R)-1-[5-amino-2-fluoro-3-(trifluoromethyl)phenyl]ethyl]-6-(1,1-dioxothian-4-yl)-2-methylquinazolin-4-amine |
|---|---|
| PubChem CID | 155562084 |
| Molecular Formula | C23H24F4N4O2S |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | N-[(1R)-1-[5-amino-2-fluoro-3-(trifluoromethyl)phenyl]ethyl]-6-(1,1-dioxothian-4-yl)-2-methylquinazolin-4-amine |
| SMILES | Cc1nc(N[C@H](C)c2cc(N)cc(C(F)(F)F)c2F)c2cc(C3CCS(=O)(=O)CC3)ccc2n1 |
| InChI | InChI=1S/C23H24F4N4O2S/c1-12(17-10-16(28)11-19(21(17)24)23(25,26)27)29-22-18-9-15(3-4-20(18)30-13(2)31-22)14-5-7-34(32,33)8-6-14/h3-4,9-12,14H,5-8,28H2,1-2H3,(H,29,30,31)/t12-/m1/s1 |
| InChIKey | DBIVQAKEOICKHV-GFCCVEGCSA-N |
| XLogP | 5.14 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|