C25H28N4O9 — CID 155562086
(2R,3R,4S)-3-acetamido-4-[[amino-[[4-(4-hydroxyphenyl)benzoyl]amino]methylidene]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 155562086) has the molecular formula C25H28N4O9 and a molecular weight of 528.52 g/mol. Its IUPAC name is (2R,3R,4S)-3-acetamido-4-[[amino-[[4-(4-hydroxyphenyl)benzoyl]amino]methylidene]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4S)-3-acetamido-4-[[amino-[[4-(4-hydroxyphenyl)benzoyl]amino]methylidene]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 155562086 |
| Molecular Formula | C25H28N4O9 |
| Molecular Weight | 528.52 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | (2R,3R,4S)-3-acetamido-4-[[amino-[[4-(4-hydroxyphenyl)benzoyl]amino]methylidene]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | CC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(C(=O)O)=C[C@@H]1/N=C(\N)NC(=O)c1ccc(-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C25H28N4O9/c1-12(31)27-20-17(10-19(24(36)37)38-22(20)21(34)18(33)11-30)28-25(26)29-23(35)15-4-2-13(3-5-15)14-6-8-16(32)9-7-14/h2-10,17-18,20-22,30,32-34H,11H2,1H3,(H,27,31)(H,36,37)(H3,26,28,29,35)/t17-,18+,20+,21+,22+/m0/s1 |
| InChIKey | OJXALGBAOXXELF-OMTGHCCBSA-N |
| XLogP | -0.94 |
| TPSA | 224.03 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.52 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|