C38H33N5O — CID 155562117
2-[4-[bis(1,2-dimethylindol-3-yl)methyl]phenyl]-5-(1-methylindol-3-yl)-1,3,4-oxadiazole (PubChem CID 155562117) has the molecular formula C38H33N5O and a molecular weight of 575.72 g/mol. Its IUPAC name is 2-[4-[bis(1,2-dimethylindol-3-yl)methyl]phenyl]-5-(1-methylindol-3-yl)-1,3,4-oxadiazole.
| Compound Name | 2-[4-[bis(1,2-dimethylindol-3-yl)methyl]phenyl]-5-(1-methylindol-3-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 155562117 |
| Molecular Formula | C38H33N5O |
| Molecular Weight | 575.72 g/mol |
| Exact Mass | 575.27 |
| IUPAC Name | 2-[4-[bis(1,2-dimethylindol-3-yl)methyl]phenyl]-5-(1-methylindol-3-yl)-1,3,4-oxadiazole |
| SMILES | Cc1c(C(c2ccc(-c3nnc(-c4cn(C)c5ccccc45)o3)cc2)c2c(C)n(C)c3ccccc23)c2ccccc2n1C |
| InChI | InChI=1S/C38H33N5O/c1-23-34(28-13-7-10-16-32(28)42(23)4)36(35-24(2)43(5)33-17-11-8-14-29(33)35)25-18-20-26(21-19-25)37-39-40-38(44-37)30-22-41(3)31-15-9-6-12-27(30)31/h6-22,36H,1-5H3 |
| InChIKey | HFYXDEPFHYDRRO-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 53.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.72 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|