C28H33N3O3 — CID 155562174
N-[[(4aR,8aR)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyran-4a-yl]methyl]-3-[2-amino-6-(2-methylphenyl)quinolin-3-yl]propanamide (PubChem CID 155562174) has the molecular formula C28H33N3O3 and a molecular weight of 459.59 g/mol. Its IUPAC name is N-[[(4aR,8aR)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyran-4a-yl]methyl]-3-[2-amino-6-(2-methylphenyl)quinolin-3-yl]propanamide.
| Compound Name | N-[[(4aR,8aR)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyran-4a-yl]methyl]-3-[2-amino-6-(2-methylphenyl)quinolin-3-yl]propanamide |
|---|---|
| PubChem CID | 155562174 |
| Molecular Formula | C28H33N3O3 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | N-[[(4aR,8aR)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyran-4a-yl]methyl]-3-[2-amino-6-(2-methylphenyl)quinolin-3-yl]propanamide |
| SMILES | Cc1ccccc1-c1ccc2nc(N)c(CCC(=O)NC[C@@]34CCCO[C@@H]3CCOC4)cc2c1 |
| InChI | InChI=1S/C28H33N3O3/c1-19-5-2-3-6-23(19)20-7-9-24-22(15-20)16-21(27(29)31-24)8-10-26(32)30-17-28-12-4-13-34-25(28)11-14-33-18-28/h2-3,5-7,9,15-16,25H,4,8,10-14,17-18H2,1H3,(H2,29,31)(H,30,32)/t25-,28-/m1/s1 |
| InChIKey | XYNBHIXLWLVKIV-LEAFIULHSA-N |
| XLogP | 4.43 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |