C17H14BN3O2S — CID 155562268
[2-(4,5,10-triazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(9),2(6),3,7,10,12(16)-hexaen-11-yl)thiophen-3-yl]boronic acid (PubChem CID 155562268) has the molecular formula C17H14BN3O2S and a molecular weight of 335.20 g/mol. Its IUPAC name is [2-(4,5,10-triazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(9),2(6),3,7,10,12(16)-hexaen-11-yl)thiophen-3-yl]boronic acid.
| Compound Name | [2-(4,5,10-triazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(9),2(6),3,7,10,12(16)-hexaen-11-yl)thiophen-3-yl]boronic acid |
|---|---|
| PubChem CID | 155562268 |
| Molecular Formula | C17H14BN3O2S |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | [2-(4,5,10-triazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(9),2(6),3,7,10,12(16)-hexaen-11-yl)thiophen-3-yl]boronic acid |
| SMILES | OB(O)c1ccsc1-c1nc2ccc3[nH]ncc3c2c2c1CCC2 |
| InChI | InChI=1S/C17H14BN3O2S/c22-18(23)12-6-7-24-17(12)16-10-3-1-2-9(10)15-11-8-19-21-13(11)4-5-14(15)20-16/h4-8,22-23H,1-3H2,(H,19,21) |
| InChIKey | BLLPPGSIIPVMOZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|