C22H28O6S — CID 155562375
(4,18-dimethoxy-2-oxatricyclo[13.3.1.13,7]icosa-1(18),3,5,7(20),15(19),16-hexaen-10-yl) methanesulfonate (PubChem CID 155562375) has the molecular formula C22H28O6S and a molecular weight of 420.53 g/mol. Its IUPAC name is (4,18-dimethoxy-2-oxatricyclo[13.3.1.13,7]icosa-1(18),3,5,7(20),15(19),16-hexaen-10-yl) methanesulfonate.
| Compound Name | (4,18-dimethoxy-2-oxatricyclo[13.3.1.13,7]icosa-1(18),3,5,7(20),15(19),16-hexaen-10-yl) methanesulfonate |
|---|---|
| PubChem CID | 155562375 |
| Molecular Formula | C22H28O6S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | (4,18-dimethoxy-2-oxatricyclo[13.3.1.13,7]icosa-1(18),3,5,7(20),15(19),16-hexaen-10-yl) methanesulfonate |
| SMILES | COc1ccc2cc1Oc1cc(ccc1OC)CCC(OS(C)(=O)=O)CCCC2 |
| InChI | InChI=1S/C22H28O6S/c1-25-19-12-9-16-6-4-5-7-18(28-29(3,23)24)11-8-17-10-13-20(26-2)22(15-17)27-21(19)14-16/h9-10,12-15,18H,4-8,11H2,1-3H3 |
| InChIKey | QDLWDJVXFDIWEJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|