C13H15IN4O3 — CID 155562414
(1R,2R,3S,4R,5S)-4-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-1-(hydroxymethyl)bicyclo[3.1.0]hexane-2,3-diol (PubChem CID 155562414) has the molecular formula C13H15IN4O3 and a molecular weight of 402.19 g/mol. Its IUPAC name is (1R,2R,3S,4R,5S)-4-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-1-(hydroxymethyl)bicyclo[3.1.0]hexane-2,3-diol.
| Compound Name | (1R,2R,3S,4R,5S)-4-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-1-(hydroxymethyl)bicyclo[3.1.0]hexane-2,3-diol |
|---|---|
| PubChem CID | 155562414 |
| Molecular Formula | C13H15IN4O3 |
| Molecular Weight | 402.19 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | (1R,2R,3S,4R,5S)-4-(4-amino-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-1-(hydroxymethyl)bicyclo[3.1.0]hexane-2,3-diol |
| SMILES | Nc1ncnc2c1c(I)cn2[C@H]1[C@H](O)[C@H](O)[C@]2(CO)C[C@H]12 |
| InChI | InChI=1S/C13H15IN4O3/c14-6-2-18(12-7(6)11(15)16-4-17-12)8-5-1-13(5,3-19)10(21)9(8)20/h2,4-5,8-10,19-21H,1,3H2,(H2,15,16,17)/t5-,8-,9+,10+,13+/m1/s1 |
| InChIKey | IUCXONHNPHDHSF-WGDVLSMGSA-N |
| XLogP | -0.11 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.19 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|