C27H31NO5 — CID 155562460
(1R,10S,11R,12S,14S,17S,18S)-18-hydroxy-4-(4-hydroxyphenyl)-14,18-dimethyl-11-[(E)-prop-1-enyl]-2-oxa-6-azatetracyclo[8.8.0.03,8.012,17]octadeca-3(8),4-diene-7,9-dione (PubChem CID 155562460) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is (1R,10S,11R,12S,14S,17S,18S)-18-hydroxy-4-(4-hydroxyphenyl)-14,18-dimethyl-11-[(E)-prop-1-enyl]-2-oxa-6-azatetracyclo[8.8.0.03,8.012,17]octadeca-3(8),4-diene-7,9-dione.
| Compound Name | (1R,10S,11R,12S,14S,17S,18S)-18-hydroxy-4-(4-hydroxyphenyl)-14,18-dimethyl-11-[(E)-prop-1-enyl]-2-oxa-6-azatetracyclo[8.8.0.03,8.012,17]octadeca-3(8),4-diene-7,9-dione |
|---|---|
| PubChem CID | 155562460 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (1R,10S,11R,12S,14S,17S,18S)-18-hydroxy-4-(4-hydroxyphenyl)-14,18-dimethyl-11-[(E)-prop-1-enyl]-2-oxa-6-azatetracyclo[8.8.0.03,8.012,17]octadeca-3(8),4-diene-7,9-dione |
| SMILES | C/C=C/[C@@H]1[C@@H]2C[C@@H](C)CC[C@@H]2[C@](C)(O)[C@@H]2Oc3c(-c4ccc(O)cc4)c[nH]c(=O)c3C(=O)[C@@H]12 |
| InChI | InChI=1S/C27H31NO5/c1-4-5-17-18-12-14(2)6-11-20(18)27(3,32)25-21(17)23(30)22-24(33-25)19(13-28-26(22)31)15-7-9-16(29)10-8-15/h4-5,7-10,13-14,17-18,20-21,25,29,32H,6,11-12H2,1-3H3,(H,28,31)/b5-4+/t14-,17+,18-,20-,21+,25+,27-/m0/s1 |
| InChIKey | PNTWBWUDGNXMNE-AICLBHKFSA-N |
| XLogP | 4.32 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|