C15H30N2O6P2S — CID 155562529
[2-[[4-(3,7-dimethyloctyl)-1,3-thiazol-2-yl]amino]-1-phosphonoethyl]phosphonic acid (PubChem CID 155562529) has the molecular formula C15H30N2O6P2S and a molecular weight of 428.43 g/mol. Its IUPAC name is [2-[[4-(3,7-dimethyloctyl)-1,3-thiazol-2-yl]amino]-1-phosphonoethyl]phosphonic acid.
| Compound Name | [2-[[4-(3,7-dimethyloctyl)-1,3-thiazol-2-yl]amino]-1-phosphonoethyl]phosphonic acid |
|---|---|
| PubChem CID | 155562529 |
| Molecular Formula | C15H30N2O6P2S |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | [2-[[4-(3,7-dimethyloctyl)-1,3-thiazol-2-yl]amino]-1-phosphonoethyl]phosphonic acid |
| SMILES | CC(C)CCCC(C)CCc1csc(NCC(P(=O)(O)O)P(=O)(O)O)n1 |
| InChI | InChI=1S/C15H30N2O6P2S/c1-11(2)5-4-6-12(3)7-8-13-10-26-15(17-13)16-9-14(24(18,19)20)25(21,22)23/h10-12,14H,4-9H2,1-3H3,(H,16,17)(H2,18,19,20)(H2,21,22,23) |
| InChIKey | UBBGRWZEBUYSIE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|