About 3-bromo-N-(3,4-dihydro-2H-chromen-4-ylmethyl)benzenesulfonamide
3-bromo-N-(3,4-dihydro-2H-chromen-4-ylmethyl)benzenesulfonamide (PubChem CID 155562648) has the molecular formula C16H16BrNO3S
and a molecular weight of 382.28 g/mol. Its IUPAC name is 3-bromo-N-(3,4-dihydro-2H-chromen-4-ylmethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 3-bromo-N-(3,4-dihydro-2H-chromen-4-ylmethyl)benzenesulfonamide |
| PubChem CID | 155562648 |
| Molecular Formula | C16H16BrNO3S |
| Molecular Weight | 382.28 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | 3-bromo-N-(3,4-dihydro-2H-chromen-4-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCOc2ccccc21)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H16BrNO3S/c17-13-4-3-5-14(10-13)22(19,20)18-11-12-8-9-21-16-7-2-1-6-15(12)16/h1-7,10,12,18H,8-9,11H2 |
| InChIKey | DSKLKBYFQRYJIM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.28 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-N-(3,4-dihydro-2H-chromen-4-ylmethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-(3,4-dihydro-2H-chromen-4-ylmethyl)benzenesulfonamide?
The IUPAC name of 3-bromo-N-(3,4-dihydro-2H-chromen-4-ylmethyl)benzenesulfonamide (CID 155562648) is 3-bromo-N-(3,4-dihydro-2H-chromen-4-ylmethyl)benzenesulfonamide.
What is the SMILES notation for 3-bromo-N-(3,4-dihydro-2H-chromen-4-ylmethyl)benzenesulfonamide?
The canonical SMILES for 3-bromo-N-(3,4-dihydro-2H-chromen-4-ylmethyl)benzenesulfonamide is O=S(=O)(NCC1CCOc2ccccc21)c1cccc(Br)c1.
What is the InChIKey of 3-bromo-N-(3,4-dihydro-2H-chromen-4-ylmethyl)benzenesulfonamide?
The InChIKey is DSKLKBYFQRYJIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16BrNO3S/c17-13-4-3-5-14(10-13)22(19,20)18-11-12-8-9-21-16-7-2-1-6-15(12)16/h1-7,10,12,18H,8-9,11H2.
What are the key properties of 3-bromo-N-(3,4-dihydro-2H-chromen-4-ylmethyl)benzenesulfonamide?
3-bromo-N-(3,4-dihydro-2H-chromen-4-ylmethyl)benzenesulfonamide has a molecular weight of 382.28 g/mol, XLogP of 3.29, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-(3,4-dihydro-2H-chromen-4-ylmethyl)benzenesulfonamide is sourced from PubChem (CID 155562648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).