C41H37Br2N3O3 — CID 155562692
1-[(6aR,11bR)-10-bromo-4-methoxy-6,6a,7,11b-tetrahydroindeno[2,1-c]quinolin-5-yl]-3-[5,6-dimethyl-3-(2-naphthalen-2-yl-2-oxoethyl)benzimidazol-3-ium-1-yl]propan-1-one bromide (PubChem CID 155562692) has the molecular formula C41H37Br2N3O3 and a molecular weight of 779.57 g/mol. Its IUPAC name is 1-[(6aR,11bR)-10-bromo-4-methoxy-6,6a,7,11b-tetrahydroindeno[2,1-c]quinolin-5-yl]-3-[5,6-dimethyl-3-(2-naphthalen-2-yl-2-oxoethyl)benzimidazol-3-ium-1-yl]propan-1-one bromide.
| Compound Name | 1-[(6aR,11bR)-10-bromo-4-methoxy-6,6a,7,11b-tetrahydroindeno[2,1-c]quinolin-5-yl]-3-[5,6-dimethyl-3-(2-naphthalen-2-yl-2-oxoethyl)benzimidazol-3-ium-1-yl]propan-1-one bromide |
|---|---|
| PubChem CID | 155562692 |
| Molecular Formula | C41H37Br2N3O3 |
| Molecular Weight | 779.57 g/mol |
| Exact Mass | 777.12 |
| IUPAC Name | 1-[(6aR,11bR)-10-bromo-4-methoxy-6,6a,7,11b-tetrahydroindeno[2,1-c]quinolin-5-yl]-3-[5,6-dimethyl-3-(2-naphthalen-2-yl-2-oxoethyl)benzimidazol-3-ium-1-yl]propan-1-one bromide |
| SMILES | COc1cccc2c1N(C(=O)CCn1c[n+](CC(=O)c3ccc4ccccc4c3)c3cc(C)c(C)cc31)C[C@@H]1Cc3ccc(Br)cc3[C@H]21.[Br-] |
| InChI | InChI=1S/C41H37BrN3O3.BrH/c1-25-17-35-36(18-26(25)2)44(23-37(46)30-12-11-27-7-4-5-8-28(27)19-30)24-43(35)16-15-39(47)45-22-31-20-29-13-14-32(42)21-34(29)40(31)33-9-6-10-38(48-3)41(33)45;/h4-14,17-19,21,24,31,40H,15-16,20,22-23H2,1-3H3;1H/q+1;/p-1/t31-,40-;/m0./s1 |
| InChIKey | FYUJMWJPTRKDPD-DMRRVDEESA-M |
| XLogP | 5.10 |
| TPSA | 55.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.57 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|